CAS 1133116-49-0

3,6-Dibromo-2-pyridinecarboxylic acid

Description:

3,6-Dibromo-2-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group and at the 3 and 6 positions with bromine atoms. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The bromine substituents can enhance the compound's reactivity and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the carboxylic acid group allows for potential interactions in biological systems, such as hydrogen bonding. Safety data should be consulted, as brominated compounds can pose environmental and health risks. Overall, 3,6-Dibromo-2-pyridinecarboxylic acid is a versatile compound with significant implications in various chemical fields.

Formula: C₆H₃Br₂NO₂

InChI: InChI=1S/C6H3Br2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)

InChI key: InChIKey=YHHZRFKRFAFHRJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C=CC(Br)=N1

Synonyms:

• 3,6-Dibromopicolinic acid
• 2-Pyridinecarboxylic acid, 3,6-dibromo-
• 3,6-Dibromo-2-pyridinecarboxylic acid

3,6-Dibromopicolinic acid

CAS: 1133116-49-0

Formula: C₆H₃Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 280.9015

Ref: IN-DA0079F0

3,6-Dibromopyridine-2-carboxylic acid

CAS: 1133116-49-0

3,6-Dibromopyridine-2-carboxylic acid

Purity: 97%

Molecular weight: 280.90g/mol

Ref: 54-OR71163

3,6-Dibromopicolinic acid

CAS: 1133116-49-0

Formula: C₆H₃Br₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 280.903

Ref: 10-F212746

3,6-Dibromopicolinic acid

CAS: 1133116-49-0

Versatile small molecule scaffold

Formula: C₆H₃Br₂NO₂

Purity: Min. 95%

Molecular weight: 280.9 g/mol

Ref: 3D-IVB11649