CAS 113334-60-4

2-(4-Hydroxyphenyl)-4-thiazolecarboxylic acid ethyl ester

Description:

2-(4-Hydroxyphenyl)-4-thiazolecarboxylic acid ethyl ester, with the CAS number 113334-60-4, is an organic compound characterized by its thiazole and phenolic functional groups. This compound typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the thiazole ring contributes to its heterocyclic nature, which can enhance its reactivity and interaction with biological targets. The ethyl ester group suggests that it may exhibit moderate lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the hydroxyl group on the phenyl ring can participate in hydrogen bonding, affecting the compound's overall stability and reactivity. Overall, this compound's unique structural features make it a subject of interest for further research in medicinal chemistry and related fields.

Formula: C₁₂H₁₁NO₃S

InChI: InChI=1S/C12H11NO3S/c1-2-16-12(15)10-7-17-11(13-10)8-3-5-9(14)6-4-8/h3-7,14H,2H2,1H3

SMILES: CCOC(=O)c1csc(c2ccc(cc2)O)n1

Synonyms:

• 4-Thiazolecarboxylic acid, 2-(4-hydroxyphenyl)-, ethyl ester

4-Thiazolecarboxylic acid, 2-(4-hydroxyphenyl)-, ethyl ester

CAS: 113334-60-4

Formula: C₁₂H₁₁NO₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 249.2856

Ref: IN-DA00901G