CymitQuimica logo

CAS 113336-24-6

:

1H-Pyrazole-1-acetamide

Description:
1H-Pyrazole-1-acetamide is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an acetamide functional group, contributing to its chemical reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the presence of the amide group. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, 1H-Pyrazole-1-acetamide can participate in various chemical reactions, including acylation and substitution, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C5H7N3O
InChI:InChI=1S/C5H7N3O/c6-5(9)4-8-3-1-2-7-8/h1-3H,4H2,(H2,6,9)
InChI key:InChIKey=PTGHHGHHFPDNBR-UHFFFAOYSA-N
SMILES:C(C(N)=O)N1C=CC=N1
Synonyms:
  • 2-(1H-Pyrazol-1-yl)acetamide
  • 2-Pyrazol-1-yl-acetamide
  • 1H-Pyrazole-1-acetamide
  • 2-Pyrazol-1-ylacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.