
CAS 113337-37-4
:2-Chloro-1-(2-nitrophenyl)ethanone
Description:
2-Chloro-1-(2-nitrophenyl)ethanone, with the CAS number 113337-37-4, is an organic compound characterized by its functional groups and structural features. It contains a chloro group and a nitrophenyl moiety, which contribute to its reactivity and potential applications in organic synthesis. The presence of the chloro substituent typically enhances electrophilic properties, making it useful in various chemical reactions, such as nucleophilic substitutions. The nitro group, known for its electron-withdrawing effects, can influence the compound's reactivity and polarity. This compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties suggest potential utility in the synthesis of pharmaceuticals or agrochemicals, where such functional groups are often integral to bioactivity. Safety data should be consulted, as compounds containing chlorine and nitro groups can pose health risks and environmental concerns. Overall, 2-Chloro-1-(2-nitrophenyl)ethanone is a noteworthy compound in the realm of synthetic organic chemistry.
Formula:C8H6ClNO3
InChI:InChI=1S/C8H6ClNO3/c9-5-8(11)6-3-1-2-4-7(6)10(12)13/h1-4H,5H2
InChI key:InChIKey=GSGZYJVMDUDKFL-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=C(N(=O)=O)C=CC=C1
Synonyms:- 2-Chloro-1-(2-nitrophenyl)ethanone
- 2-Chloro-1-(2-nitrophenyl)ethan-1-one
- 2-Chloro-2′-nitroacetophenone
- Ethanone, 2-chloro-1-(2-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.