CAS 113342-33-9

5-(2,4-Dimethylphenyl)-1H-pyrazole-3-carboxylic acid

Description:

5-(2,4-Dimethylphenyl)-1H-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of the 2,4-dimethylphenyl group contributes to its hydrophobic characteristics, while the carboxylic acid functional group (-COOH) imparts acidic properties and enhances its solubility in polar solvents. This compound is often studied for its potential biological activities, including anti-inflammatory and analgesic effects, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding due to the carboxylic acid group, which can influence its reactivity and binding affinity in biological systems. Additionally, the compound's stability and reactivity can be affected by the substituents on the phenyl ring, which can modulate its electronic properties. Overall, 5-(2,4-Dimethylphenyl)-1H-pyrazole-3-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1S/C12H12N2O2/c1-7-3-4-9(8(2)5-7)10-6-11(12(15)16)14-13-10/h3-6H,1-2H3,(H,13,14)(H,15,16)

InChI key: InChIKey=XSEUPOAEAAAQGG-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(C(O)=O)=NN2)C=CC(C)=C1

Synonyms:

• 5-(2,4-Dimethylphenyl)-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 5-(2,4-dimethylphenyl)-

3-(2,4-Dimethylphenyl)-1H-pyrazole-5-carboxylic acid

CAS: 113342-33-9

Formula: C₁₂H₁₂N₂O₂

Purity: 95.0%

Molecular weight: 216.24

Ref: 10-F496341