CAS 1133430-71-3
:1-[3-(1,1-Dimethylethyl)phenyl]-5-nitro-1H-indazol-3-amine
Description:
1-[3-(1,1-Dimethylethyl)phenyl]-5-nitro-1H-indazol-3-amine, identified by its CAS number 1133430-71-3, is a chemical compound that belongs to the class of indazole derivatives. This substance features a nitro group and an amine functional group, contributing to its potential reactivity and biological activity. The presence of the bulky tert-butyl group (1,1-dimethylethyl) on the phenyl ring may influence its steric properties and solubility, potentially affecting its interactions in biological systems. The compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic aromatic structures, which can impact its pharmacokinetics if studied for medicinal applications. Additionally, the nitro group may serve as a site for reduction reactions, which can be relevant in various chemical transformations. Overall, this compound's unique structural features suggest potential utility in pharmaceutical research, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C17H18N4O2
InChI:InChI=1S/C17H18N4O2/c1-17(2,3)11-5-4-6-12(9-11)20-15-8-7-13(21(22)23)10-14(15)16(18)19-20/h4-10H,1-3H3,(H2,18,19)
InChI key:InChIKey=HUSBZBGIIMNOFC-UHFFFAOYSA-N
SMILES:NC=1C=2C(N(N1)C3=CC(C(C)(C)C)=CC=C3)=CC=C(N(=O)=O)C2
Synonyms:- 1H-Indazol-3-amine, 1-[3-(1,1-dimethylethyl)phenyl]-5-nitro-
- [1-(3-tert-Butylphenyl)-5-nitro-1H-indazol-3-yl]amine
- 1-(3-tert-Butylphenyl)-5-nitroindazol-3-amine
- 1-[3-(1,1-Dimethylethyl)phenyl]-5-nitro-1H-indazol-3-amine
- 1-(3-(tert-Butyl)phenyl)-5-nitro-1H-indazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
