CymitQuimica logo

CAS 113348-25-7

:

cyclopropyl(thiophen-3-yl)methanone

Description:
Cyclopropyl(thiophen-3-yl)methanone is an organic compound characterized by the presence of a cyclopropyl group and a thiophene ring, specifically at the 3-position of the thiophene. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The cyclopropyl moiety is known for its unique strain and can influence the compound's overall stability and reactivity. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts additional electronic properties and can participate in various chemical reactions, including electrophilic substitutions. Cyclopropyl(thiophen-3-yl)methanone may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its structural characteristics suggest potential applications in the development of pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties, such as solubility, melting point, and boiling point, would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C8H8OS
InChI:InChI=1/C8H8OS/c9-8(6-1-2-6)7-3-4-10-5-7/h3-6H,1-2H2
SMILES:C1CC1C(=O)c1ccsc1
Synonyms:
  • Cyclopropyl(3-thienyl)methanone
  • Methanone, cyclopropyl-3-thienyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.