CymitQuimica logo

CAS 113366-76-0

:

2-Ethyl-5-methyl-4-thiazolecarboxylic acid

Description:
2-Ethyl-5-methyl-4-thiazolecarboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The thiazole moiety imparts unique chemical reactivity, making it useful in various synthetic applications, particularly in the pharmaceutical and agrochemical industries. Its structure suggests potential biological activity, which may include antimicrobial or antifungal properties, although specific biological data would depend on empirical studies. The compound's CAS number, 113366-76-0, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, 2-Ethyl-5-methyl-4-thiazolecarboxylic acid is a valuable compound in organic synthesis and may serve as a building block for more complex molecules.
Formula:C7H9NO2S
InChI:InChI=1S/C7H9NO2S/c1-3-5-8-6(7(9)10)4(2)11-5/h3H2,1-2H3,(H,9,10)
InChI key:InChIKey=XJWWVWWDMLFLCZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)SC(CC)=N1
Synonyms:
  • 4-Thiazolecarboxylic acid, 2-ethyl-5-methyl-
  • 2-Ethyl-5-methyl-1,3-thiazole-4-carboxylic acid
  • 2-Ethyl-5-methyl-4-thiazolecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.