CAS 1133720-83-8

2-Bromo-3-hydroxybenzeneacetic acid

Description:

2-Bromo-3-hydroxybenzeneacetic acid, also known as a derivative of phenolic compounds, features a bromine atom and a hydroxyl group attached to a benzene ring, along with an acetic acid moiety. This compound typically exhibits characteristics common to aromatic acids, including moderate solubility in polar solvents due to the presence of the hydroxyl and carboxylic acid functional groups. The bromine substituent can influence the compound's reactivity, making it useful in various chemical reactions, such as electrophilic substitutions. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing its interactions in biological systems. Additionally, the presence of both the bromine and the carboxylic acid functional groups may impart unique properties, such as increased acidity compared to unsubstituted benzoic acids. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior.

Formula: C₈H₇BrO₃

InChI: InChI=1S/C8H7BrO3/c9-8-5(4-7(11)12)2-1-3-6(8)10/h1-3,10H,4H2,(H,11,12)

InChI key: InChIKey=JJJDRPUHOHCRKY-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(Br)C(O)=CC=C1

Synonyms:

• Benzeneacetic acid, 2-bromo-3-hydroxy-
• 2-Bromo-3-hydroxybenzeneacetic acid
• 2-(2-Bromo-3-hydroxyphenyl)acetic acid