CymitQuimica logo

CAS 113391-65-4

:

2-Fluoro-1,3-benzenedimethanethiol

Description:
2-Fluoro-1,3-benzenedimethanethiol, with the CAS number 113391-65-4, is an organofluorine compound characterized by the presence of a fluorine atom and two thiol (-SH) groups attached to a benzene ring. This compound features a unique structure that combines aromaticity with the reactivity of thiol groups, making it potentially useful in various chemical applications, including organic synthesis and materials science. The fluorine substituent can influence the compound's electronic properties, enhancing its reactivity and solubility in certain solvents. Additionally, the thiol groups can participate in various chemical reactions, such as nucleophilic substitutions and the formation of disulfide bonds, which are important in biochemistry and polymer chemistry. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 2-Fluoro-1,3-benzenedimethanethiol represents a versatile chemical entity with potential applications in research and industry.
Formula:C8H9FS2
InChI:InChI=1S/C8H9FS2/c9-8-6(4-10)2-1-3-7(8)5-11/h1-3,10-11H,4-5H2
InChI key:InChIKey=SWRQZVVZLQFDFZ-UHFFFAOYSA-N
SMILES:C(S)C1=C(F)C(CS)=CC=C1
Synonyms:
  • 1-Fluoro-2,6-bis(mercaptomethyl)benzene
  • 1,3-Benzenedimethanethiol, 2-fluoro-
  • (2-Fluoro-1,3-phenylene)dimethanethiol
  • 2-Fluoro-1,3-benzenedimethanethiol
  • (2-Fluoro-3-mercaptomethylphenyl)methanethiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.