
CAS 113391-96-1
:1,2-Cyclohexanediol, monomethanesulfonate, trans-
Description:
1,2-Cyclohexanediol, monomethanesulfonate, trans- is a chemical compound characterized by its structure, which includes a cyclohexane ring with two hydroxyl (-OH) groups positioned at the 1 and 2 carbon atoms, and a methanesulfonate group attached to one of the hydroxyls. This compound is typically a colorless to pale yellow liquid and is soluble in water, making it useful in various applications, including as a reagent in organic synthesis and in the formulation of surfactants. The presence of the methanesulfonate group enhances its reactivity and solubility, contributing to its utility in chemical processes. Additionally, the trans configuration of the hydroxyl groups influences its physical and chemical properties, such as boiling point and reactivity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1,2-Cyclohexanediol, monomethanesulfonate, trans- is a versatile compound with applications in both research and industrial settings.
Formula:C7H14O4S
InChI:InChI=1/C7H14O4S/c1-12(9,10)11-7-5-3-2-4-6(7)8/h6-8H,2-5H2,1H3/t6-,7-/s2
InChI key:InChIKey=ZAWFZEFXFJKOLK-WZTWBHKBNA-N
SMILES:O(S(C)(=O)=O)[C@H]1[C@H](O)CCCC1
Synonyms:- 1,2-Cyclohexanediol, monomethanesulfonate, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2-Cyclohexanediol, monomethanesulfonate, trans- (9CI)
CAS:Formula:C7H14O4SMolecular weight:194.2487
