CymitQuimica logo

CAS 113394-33-5

:

4-(2,5-Dioxo-1-imidazolidinyl)benzaldehyde 1-oxime

Description:
4-(2,5-Dioxo-1-imidazolidinyl)benzaldehyde 1-oxime, identified by its CAS number 113394-33-5, is a chemical compound characterized by its unique structural features, which include an imidazolidine ring and an oxime functional group. This compound typically exhibits properties associated with both aldehydes and oximes, such as reactivity towards nucleophiles and potential for tautomerization. The presence of the dioxo group contributes to its stability and may influence its reactivity in various chemical reactions, including condensation and cyclization processes. The benzaldehyde moiety provides aromatic characteristics, which can affect solubility and interaction with other molecules. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential biological activities, including antimicrobial and anticancer properties. Additionally, the oxime group can serve as a precursor for further chemical modifications, making it a versatile building block in organic synthesis. Overall, this compound's unique combination of functional groups positions it as an interesting subject for research in both synthetic and medicinal chemistry.
Formula:C10H9N3O3
InChI:InChI=1S/C10H9N3O3/c14-9-6-11-10(15)13(9)8-3-1-7(2-4-8)5-12-16/h1-5,16H,6H2,(H,11,15)
InChI key:InChIKey=WNMRACBDZWBKID-UHFFFAOYSA-N
SMILES:O=C1N(C2=CC=C(C=NO)C=C2)C(=O)NC1
Synonyms:
  • 4-(2,5-Dioxo-1-imidazolidinyl)benzaldehyde 1-oxime
  • Benzaldehyde, 4-(2,5-dioxo-1-imidazolidinyl)-, 1-oxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.