CAS 1134-40-3
:2,3,6,7-Tetramethylnaphthalene
Description:
2,3,6,7-Tetramethylnaphthalene is an organic compound belonging to the naphthalene family, characterized by its polycyclic aromatic structure. It features four methyl groups attached to the naphthalene ring system, specifically at the 2, 3, 6, and 7 positions. This compound is typically a colorless to pale yellow solid at room temperature and has a relatively high melting point compared to many other aromatic compounds. It is insoluble in water but soluble in organic solvents such as ethanol and ether. 2,3,6,7-Tetramethylnaphthalene is known for its stability and resistance to oxidation, making it useful in various chemical applications, including as a reference material in analytical chemistry. Its unique structure contributes to its distinct physical and chemical properties, including its potential use in the synthesis of other organic compounds. Additionally, it may exhibit interesting electronic and optical properties due to its aromatic nature, which can be explored in materials science and organic electronics.
Formula:C14H16
InChI:InChI=1S/C14H16/c1-9-5-13-7-11(3)12(4)8-14(13)6-10(9)2/h5-8H,1-4H3
InChI key:InChIKey=QYEOHOUFXNEWEI-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C(C)C(C)=C2)C=C1C
Synonyms:- 2,3,6,7-Tetramethylnaphthalene
- Naphthalene, 2,3,6,7-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
