CAS 1134-82-3
:1-benzyl-3-methyl-1H-pyrazol-5-amine
Description:
1-Benzyl-3-methyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a benzyl group attached to the nitrogen of the pyrazole, along with a methyl group at the 3-position and an amino group at the 5-position of the pyrazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the amino group suggests potential basicity and reactivity, making it a candidate for various chemical reactions, including those involving nucleophilic substitution. Its structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrazole derivatives. Additionally, the compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, which can be explored in research settings. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C11H13N3
InChI:InChI=1/C11H13N3/c1-9-7-11(12)14(13-9)8-10-5-3-2-4-6-10/h2-7H,8,12H2,1H3
SMILES:Cc1cc(N)n(Cc2ccccc2)n1
Synonyms:- 1H-Pyrazol-5-amine, 3-methyl-1-(phenylmethyl)-
- 1-Benzyl-3-methyl-1H-pyrazol-5-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzyl-3-methyl-1h-pyrazol-5-amine hydrochloride
CAS:Formula:C11H13N3Purity:97%Color and Shape:SolidMolecular weight:187.24101-Benzyl-3-methyl-1h-pyrazol-5-amine
CAS:1-Benzyl-3-methyl-1h-pyrazol-5-aminePurity:97%Molecular weight:187.25g/molRef: 10-F640036
1g235.00€5g585.00€10g1,037.00€2.5g362.00€50mg64.00€100mg91.00€250mg120.00€500mg183.00€1-Benzyl-3-methyl-1H-pyrazol-5-amine HCl
CAS:1-Benzyl-3-methyl-1H-pyrazol-5-amine HCl is a fine chemical that can be used as a versatile building block in research or as an intermediate in the synthesis of complex compounds. It has been shown to be a useful reagent for the preparation of speciality chemicals and reaction components. 1-Benzyl-3-methyl-1H-pyrazol-5-amine HCl has been shown to be a high quality compound with CAS No. 113482–3, which is listed on the Chemical Abstracts Service registry.Formula:C11H13N3·HClPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:223.7 g/mol



