
CAS 1134-85-6
:Phenol, 2-amino-4,6-dinitro-, monoammonium salt
Description:
Phenol, 2-amino-4,6-dinitro-, monoammonium salt, commonly referred to as 2-amino-4,6-dinitrophenol ammonium salt, is an organic compound characterized by the presence of both amino and nitro functional groups attached to a phenolic structure. This compound typically appears as a yellow to orange crystalline solid and is known for its high solubility in water due to the ammonium salt formation. The presence of nitro groups contributes to its strong electron-withdrawing properties, which can influence its reactivity and stability. It is often utilized in various applications, including as a reagent in organic synthesis and in the production of dyes and explosives. However, due to its potential toxicity and environmental impact, handling and disposal must be conducted with care. The compound is also known for its acidic properties, which can affect its behavior in different chemical environments. Overall, its unique structure and properties make it a subject of interest in both industrial and research settings.
Formula:C6H5N3O5·H3N
InChI:InChI=1S/C6H5N3O5.H3N/c7-4-1-3(8(11)12)2-5(6(4)10)9(13)14;/h1-2,10H,7H2;1H3
InChI key:InChIKey=QVQATLCZPOLIEI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(N(=O)=O)=CC(N)=C1O.N
Synonyms:- Phenol, 2-amino-4,6-dinitro-, monoammonium salt
- Ammonium picramate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenol, 2-amino-4,6-dinitro-, monoammonium salt (8CI,9CI)
CAS:Formula:C6H9N4O5Molecular weight:217.1595
