CymitQuimica logo

CAS 113402-98-5

:

2-[3-(Triethoxysilyl)propyl]-1H-isoindole-1,3(2H)-dione

Description:
2-[3-(Triethoxysilyl)propyl]-1H-isoindole-1,3(2H)-dione, with CAS number 113402-98-5, is a chemical compound characterized by its unique structure that combines an isoindole moiety with a triethoxysilyl group. This compound typically exhibits properties such as solubility in organic solvents and potential reactivity due to the presence of the silyl group, which can facilitate bonding with silicate surfaces or polymers. The isoindole structure contributes to its stability and may impart specific electronic properties, making it useful in various applications, including as a coupling agent in silane chemistry, surface modification, and potentially in the development of advanced materials. Its triethoxysilyl group allows for the formation of siloxane bonds, enhancing adhesion and compatibility with inorganic substrates. Overall, this compound is of interest in fields such as materials science, coatings, and surface engineering due to its multifunctional characteristics.
Formula:C17H25NO5Si
InChI:InChI=1S/C17H25NO5Si/c1-4-21-24(22-5-2,23-6-3)13-9-12-18-16(19)14-10-7-8-11-15(14)17(18)20/h7-8,10-11H,4-6,9,12-13H2,1-3H3
InChI key:InChIKey=GSVQWQIWKHILJQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCC[Si](OCC)(OCC)OCC)=CC=CC2
Synonyms:
  • 2-[3-(Triethoxysilyl)propyl]-1H-isoindole-1,3(2H)-dione
  • N-[3-(Triethoxysilyl)propyl]phthalamide
  • 1H-Isoindole-1,3(2H)-dione, 2-[3-(triethoxysilyl)propyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.