CymitQuimica logo

CAS 113411-18-0

:

1-Undecyl-1H-pyrrole-2,5-dione

Description:
1-Undecyl-1H-pyrrole-2,5-dione, with the CAS number 113411-18-0, is an organic compound characterized by its pyrrole structure, which features a five-membered aromatic ring containing nitrogen. This compound is notable for its long undecyl chain, which contributes to its hydrophobic properties and potential applications in various fields, including materials science and organic electronics. The presence of the dione functional groups indicates that it has two carbonyl (C=O) functionalities, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound's unique structure may also impart interesting electronic and optical properties, making it a candidate for use in organic semiconductors or as a building block in the synthesis of more complex molecules. Additionally, its solubility characteristics are influenced by the length of the undecyl chain, affecting its interactions in different solvents. Overall, 1-Undecyl-1H-pyrrole-2,5-dione is a versatile compound with potential applications in advanced materials and organic synthesis.
Formula:C15H25NO2
InChI:InChI=1S/C15H25NO2/c1-2-3-4-5-6-7-8-9-10-13-16-14(17)11-12-15(16)18/h11-12H,2-10,13H2,1H3
InChI key:InChIKey=SGWFSFTYSPSADW-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC)N1C(=O)C=CC1=O
Synonyms:
  • 1H-Pyrrole-2,5-dione, 1-undecyl-
  • 1-Undecylpyrrole-2,5-dione
  • 1-Undecyl-1H-pyrrole-2,5-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.