
CAS 113411-25-9
:5-(2-Methylpropyl)-2-thiophenesulfonamide
Description:
5-(2-Methylpropyl)-2-thiophenesulfonamide is a chemical compound characterized by its sulfonamide functional group attached to a thiophene ring. The presence of the thiophene moiety imparts unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound features a branched alkyl group, specifically a 2-methylpropyl group, which can influence its solubility and biological activity. Sulfonamides are known for their antibacterial properties, and the structural modifications in this compound may enhance its efficacy or selectivity. Additionally, the compound's stability, reactivity, and potential interactions with biological targets can be influenced by the thiophene and sulfonamide groups. Overall, 5-(2-Methylpropyl)-2-thiophenesulfonamide represents a class of compounds that may exhibit significant pharmacological properties, warranting further investigation into its potential applications in medicinal chemistry.
Formula:C8H13NO2S2
InChI:InChI=1S/C8H13NO2S2/c1-6(2)5-7-3-4-8(12-7)13(9,10)11/h3-4,6H,5H2,1-2H3,(H2,9,10,11)
InChI key:InChIKey=RGMLDWRBTCYHDE-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1SC(CC(C)C)=CC1
Synonyms:- 5-(2-Methylpropyl)-2-thiophenesulfonamide
- 5-Isobutyl-2-thiophenesulfonamide
- 2-Thiophenesulfonamide, 5-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
