CAS 1134331-37-5

3,5-Dihydroxybenzenecarboximidamide

Description:

3,5-Dihydroxybenzenecarboximidamide is an organic compound characterized by the presence of two hydroxyl groups (-OH) attached to a benzene ring, along with a carboximidamide functional group. This compound features a benzene core with hydroxyl substituents at the 3 and 5 positions, which can influence its reactivity and solubility. The carboximidamide group contributes to its potential as a ligand in coordination chemistry and may exhibit biological activity due to its ability to form hydrogen bonds. The presence of hydroxyl groups typically enhances the compound's polarity, making it more soluble in polar solvents. Additionally, the structural arrangement may allow for intramolecular hydrogen bonding, affecting its stability and reactivity. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral properties would depend on the molecular interactions and the environment in which the compound is studied. Overall, 3,5-Dihydroxybenzenecarboximidamide is of interest in various fields, including medicinal chemistry and materials science.

Formula: C₇H₈N₂O₂

InChI: InChI=1S/C7H8N2O2/c8-7(9)4-1-5(10)3-6(11)2-4/h1-3,10-11H,(H3,8,9)

InChI key: InChIKey=LXCMFWXRKJJBDY-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC(O)=CC(O)=C1

Synonyms:

• Benzenecarboximidamide, 3,5-dihydroxy-
• 3,5-Dihydroxybenzenecarboximidamide