CymitQuimica logo

CAS 1134334-38-5

:

6-Methyl-1-propyl-1H-indole-3-carboxaldehyde

Description:
6-Methyl-1-propyl-1H-indole-3-carboxaldehyde is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a carboxaldehyde functional group (-CHO) at the 3-position of the indole ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. The methyl and propyl substituents at the 6 and 1 positions, respectively, influence its physical properties, such as solubility and boiling point. This compound may exhibit biological activity, as many indole derivatives are known for their pharmacological properties. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 6-Methyl-1-propyl-1H-indole-3-carboxaldehyde represents a unique structure within the indole family, with implications for both synthetic and biological applications.
Formula:C13H15NO
InChI:InChI=1S/C13H15NO/c1-3-6-14-8-11(9-15)12-5-4-10(2)7-13(12)14/h4-5,7-9H,3,6H2,1-2H3
InChI key:InChIKey=VHZGEDGRIIXDNU-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(C(C=O)=C1)=CC=C(C)C2
Synonyms:
  • 1H-Indole-3-carboxaldehyde, 6-methyl-1-propyl-
  • 6-Methyl-1-propyl-1H-indole-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.