CAS 1134334-42-1
:2,6-Dimethyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde
Description:
2,6-Dimethyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features two methyl groups at the 2 and 6 positions of the indole, contributing to its hydrophobic characteristics and potential biological activity. The presence of a phenylmethyl group at the 1-position enhances its aromatic properties, while the aldehyde functional group at the 3-position introduces reactivity, particularly in condensation reactions and as a potential electrophile. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, and it may be sensitive to light and air, necessitating careful handling and storage. Overall, 2,6-Dimethyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde represents a complex structure with potential applications in various chemical and pharmaceutical fields.
Formula:C18H17NO
InChI:InChI=1S/C18H17NO/c1-13-8-9-16-17(12-20)14(2)19(18(16)10-13)11-15-6-4-3-5-7-15/h3-10,12H,11H2,1-2H3
InChI key:InChIKey=JRXSFENRMIPCDT-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(C=O)=C1C)=CC=C(C)C2)C3=CC=CC=C3
Synonyms:- 1H-Indole-3-carboxaldehyde, 2,6-dimethyl-1-(phenylmethyl)-
- 2,6-Dimethyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.