CAS 1134334-45-4
:5-Methyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde
Description:
5-Methyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methyl group at the 5-position and a phenylmethyl group at the 1-position, contributing to its unique chemical properties. The presence of the aldehyde functional group at the 3-position makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic synthesis processes. The compound's molecular structure suggests it may exhibit biological activity, potentially interacting with various biological targets due to the indole moiety, which is known for its presence in many natural products and pharmaceuticals. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 5-Methyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde is of interest in both synthetic organic chemistry and medicinal chemistry for its potential applications.
Formula:C17H15NO
InChI:InChI=1S/C17H15NO/c1-13-7-8-17-16(9-13)15(12-19)11-18(17)10-14-5-3-2-4-6-14/h2-9,11-12H,10H2,1H3
InChI key:InChIKey=DIFBXYXXTBILIQ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(N(CC3=CC=CC=C3)C1)=CC=C(C)C2
Synonyms:- 1-Benzyl-5-methyl-1H-indole-3-carbaldehyde
- 1H-Indole-3-carboxaldehyde, 5-methyl-1-(phenylmethyl)-
- 1-Benzyl-5-methylindole-3-carbaldehyde
- 5-Methyl-1-(phenylmethyl)-1H-indole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.