CAS 1134334-49-8
:5-(6-Methyl-1H-indol-3-yl)-2-thiazolamine
Description:
5-(6-Methyl-1H-indol-3-yl)-2-thiazolamine is an organic compound characterized by its unique structural features, which include an indole moiety and a thiazole ring. The presence of the methyl group on the indole enhances its hydrophobic properties, while the thiazole ring contributes to its potential biological activity. This compound is typically classified as an amine due to the presence of the amino group (-NH2) attached to the thiazole. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may exhibit various pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would depend on empirical studies. Additionally, its solubility, stability, and reactivity can be influenced by the functional groups present, which are critical for its application in research and industry. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C12H11N3S
InChI:InChI=1S/C12H11N3S/c1-7-2-3-8-9(5-14-10(8)4-7)11-6-15-12(13)16-11/h2-6,14H,1H3,(H2,13,15)
InChI key:InChIKey=ZXHGUUBXAHUBQI-UHFFFAOYSA-N
SMILES:NC=1SC(C=2C=3C(NC2)=CC(C)=CC3)=CN1
Synonyms:- 5-(6-Methyl-1H-indol-3-yl)-2-thiazolamine
- 2-Thiazolamine, 5-(6-methyl-1H-indol-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.