CAS 1134334-66-9

2-Chloro-1-(5-ethoxy-1H-indol-3-yl)ethanone

Description:

2-Chloro-1-(5-ethoxy-1H-indol-3-yl)ethanone is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chloro group at the second position and an ethanone functional group contributes to its reactivity and potential applications in organic synthesis. The ethoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound may exhibit properties typical of indole derivatives, such as potential pharmacological effects, including anti-inflammatory or anticancer activities, although specific biological data would depend on empirical studies. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. As with many synthetic organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards. Further research is necessary to fully elucidate its properties and potential applications in medicinal chemistry or material science.

Formula: C₁₂H₁₂ClNO₂

InChI: InChI=1S/C12H12ClNO2/c1-2-16-8-3-4-11-9(5-8)10(7-14-11)12(15)6-13/h3-5,7,14H,2,6H2,1H3

InChI key: InChIKey=GYINGPYHYOAAMY-UHFFFAOYSA-N

SMILES: C(CCl)(=O)C=1C=2C(NC1)=CC=C(OCC)C2

Synonyms:

• 2-Chloro-1-(5-ethoxy-1H-indol-3-yl)ethanone
• Ethanone, 2-chloro-1-(5-ethoxy-1H-indol-3-yl)-