CAS 1134334-68-1

2-Iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)ethanone

Description:

2-Iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)ethanone is a chemical compound characterized by its complex structure, which includes an indole moiety substituted with a methoxy group and two methyl groups. The presence of the iodo substituent enhances its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The ethanone functional group indicates that it contains a carbonyl (C=O) group, which contributes to its reactivity and potential applications in organic synthesis. This compound may exhibit interesting biological activities due to its indole structure, which is often associated with pharmacological properties. Additionally, the methoxy group can influence the compound's solubility and electronic properties. As with many organic compounds, its stability and reactivity can be affected by environmental factors such as temperature and pH. Overall, 2-Iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)ethanone represents a unique structure that may be of interest in medicinal chemistry and synthetic organic chemistry.

Formula: C₁₃H₁₄INO₂

InChI: InChI=1S/C13H14INO2/c1-8-13(12(16)7-14)10-6-9(17-3)4-5-11(10)15(8)2/h4-6H,7H2,1-3H3

InChI key: InChIKey=IWDPQQZCTAJEGR-UHFFFAOYSA-N

SMILES: C(CI)(=O)C=1C=2C(N(C)C1C)=CC=C(OC)C2

Synonyms:

• Ethanone, 2-iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)-
• 2-Iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)ethanone

2-Iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)-ethanone

Controlled Product

CAS: 1134334-68-1

Please enquire for more information about 2-Iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)-ethanone including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₄INO₂

Purity: Min. 95%

Molecular weight: 343.16 g/mol

Ref: 3D-JVB33468