CymitQuimica logo

CAS 1134334-82-9

:

4,7-Dimethoxy-1H-indole-2-carboxylic acid hydrazide

Description:
4,7-Dimethoxy-1H-indole-2-carboxylic acid hydrazide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific hydrazide derivative features two methoxy groups at the 4 and 7 positions of the indole ring, contributing to its unique chemical properties and potential biological activity. The presence of the carboxylic acid and hydrazide functional groups suggests that it may participate in various chemical reactions, including those involving amide formation or hydrazone synthesis. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the methoxy substituents and the hydrazide moiety. As with many indole derivatives, it may also show potential as a scaffold for drug development, particularly in the fields of neuropharmacology and cancer research. Further studies would be necessary to fully elucidate its biological activities and potential applications.
Formula:C11H13N3O3
InChI:InChI=1S/C11H13N3O3/c1-16-8-3-4-9(17-2)10-6(8)5-7(13-10)11(15)14-12/h3-5,13H,12H2,1-2H3,(H,14,15)
InChI key:InChIKey=WPFNJKJJDPYHED-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(OC)C=C1)NC(C(NN)=O)=C2
Synonyms:
  • 4,7-Dimethoxy-1H-indole-2-carboxylic acid hydrazide
  • 1H-Indole-2-carboxylic acid, 4,7-dimethoxy-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.