CAS 1134335-00-4
:2,3-Dihydro-2-(4-methylphenyl)-1,3-dioxo-1H-isoindole-5-carbonyl chloride
Description:
2,3-Dihydro-2-(4-methylphenyl)-1,3-dioxo-1H-isoindole-5-carbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a dioxo isoindole framework. This compound features a carbonyl chloride functional group, making it reactive and suitable for further chemical modifications. The presence of the 4-methylphenyl substituent contributes to its aromatic character and may influence its solubility and reactivity. Typically, compounds of this nature are utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to their potential biological activity. The dioxo moiety suggests the possibility of engaging in various chemical reactions, such as nucleophilic attacks, which can lead to the formation of diverse derivatives. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvent used. Overall, this compound exemplifies the intricate nature of organic chemistry and the potential for creating complex molecules with specific functionalities.
Formula:C16H10ClNO3
InChI:InChI=1S/C16H10ClNO3/c1-9-2-5-11(6-3-9)18-15(20)12-7-4-10(14(17)19)8-13(12)16(18)21/h2-8H,1H3
InChI key:InChIKey=VCXUCGXULQWROW-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C=2C1=CC(C(Cl)=O)=CC2)C3=CC=C(C)C=C3
Synonyms:- 2,3-Dihydro-2-(4-methylphenyl)-1,3-dioxo-1H-isoindole-5-carbonyl chloride
- 1H-Isoindole-5-carbonyl chloride, 2,3-dihydro-2-(4-methylphenyl)-1,3-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.