CAS 1134335-21-9

2,4-Dihydro-5-(phenoxymethyl)-4-propyl-3H-1,2,4-triazole-3-thione

Description:

2,4-Dihydro-5-(phenoxymethyl)-4-propyl-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The phenoxymethyl group suggests that it has a phenolic moiety, which can enhance its solubility and interaction with biological systems. The propyl group adds to its hydrophobic character, influencing its partitioning in various environments. This compound may exhibit fungicidal or herbicidal properties, making it of interest in agricultural chemistry. Its specific applications and efficacy would depend on its interaction with target organisms and environmental conditions. As with many triazole derivatives, it may also be studied for its potential in medicinal chemistry, particularly in the development of pharmaceuticals. Safety and handling considerations are essential, as with all chemical substances, due to potential toxicity or environmental impact.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1S/C12H15N3OS/c1-2-8-15-11(13-14-12(15)17)9-16-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,14,17)

InChI key: InChIKey=DXEGKLFXEHWCLC-UHFFFAOYSA-N

SMILES: C(OC1=CC=CC=C1)C=2N(CCC)C(=S)NN2

Synonyms:

• 2,4-Dihydro-5-(phenoxymethyl)-4-propyl-3H-1,2,4-triazole-3-thione
• 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-(phenoxymethyl)-4-propyl-