
CAS 113443-65-5
:1-Butoxy-1-methoxybutane
Description:
1-Butoxy-1-methoxybutane, with the CAS number 113443-65-5, is an organic compound belonging to the class of ethers. It is characterized by its structure, which includes a butoxy group and a methoxy group, contributing to its unique properties. This substance is typically a colorless liquid with a moderate boiling point and low viscosity, making it suitable for various applications. It is known for its solvent properties, often used in formulations for paints, coatings, and cleaning agents due to its ability to dissolve a wide range of organic materials. Additionally, 1-butoxy-1-methoxybutane exhibits low toxicity and is considered to have a relatively low environmental impact compared to other solvents. Its chemical stability and compatibility with various substances make it a valuable component in industrial processes. However, like many organic solvents, it should be handled with care, ensuring proper ventilation and protective measures to minimize exposure. Overall, its combination of solvent capabilities and safety profile makes it a useful compound in both industrial and laboratory settings.
Formula:C9H20O2
InChI:InChI=1S/C9H20O2/c1-4-6-8-11-9(10-3)7-5-2/h9H,4-8H2,1-3H3
InChI key:InChIKey=MPAZMSQJQTWSJW-UHFFFAOYSA-N
SMILES:C(OCCCC)(CCC)OC
Synonyms:- 1-n-Butoxy-1-methoxybutane
- 1-Butoxy-1-methoxybutane
- Butane, 1-butoxy-1-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
