CAS 113457-05-9
:Ledoxantrone
Description:
Ledoxantrone, with the CAS number 113457-05-9, is an anthraquinone derivative that exhibits antineoplastic properties, primarily used in the treatment of certain types of cancer, including leukemia and solid tumors. It functions as a DNA intercalator, disrupting the replication and transcription processes within cancer cells, which ultimately leads to cell death. Ledoxantrone is characterized by its ability to generate reactive oxygen species, contributing to its cytotoxic effects. The compound is typically administered intravenously and has a specific pharmacokinetic profile, including a moderate half-life and distribution characteristics that allow it to penetrate tissues effectively. Its side effects may include myelosuppression, gastrointestinal disturbances, and potential cardiotoxicity, necessitating careful monitoring during treatment. As a chemotherapeutic agent, ledoxantrone represents a targeted approach in oncology, although its use is often limited by its toxicity profile and the development of resistance in some cancer types.
Formula:C21H30Cl3N5OS
InChI:InChI=1/C21H27N5OS.3ClH/c1-3-25(4-2)11-12-26-17-8-7-16(23-10-9-22)21-19(17)20(24-26)15-6-5-14(27)13-18(15)28-21;;;/h5-8,13,23,27H,3-4,9-12,22H2,1-2H3;3*1H
Synonyms:- 5-[(2-aminoethyl)amino]-2-[2-(ethylamino)ethyl]-1,2-dihydro-8H-thiochromeno[4,3,2-cd]indazol-8-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ledoxantrone
CAS:Ledoxantrone, a benzopyranoindazole, stabilizes DNA-topoisomerase II complexes and blocks helicases; shows preclinical promise.Formula:C21H27N5OSColor and Shape:SolidMolecular weight:397.54
