CAS 113457-06-0

5-[(2-Aminoethyl)amino]-2-[2-(diethylamino)ethyl]-2H-[1]benzothiopyrano[4,3,2-cd]indazol-9-ol

Description:

The chemical substance known as 5-[(2-Aminoethyl)amino]-2-[2-(diethylamino)ethyl]-2H-[1]benzothiopyrano[4,3,2-cd]indazol-9-ol, with the CAS number 113457-06-0, is a complex organic compound characterized by its multi-functional groups and heterocyclic structure. It features a benzothiopyrano framework fused with an indazole moiety, which contributes to its potential biological activity. The presence of aminoethyl and diethylamino groups suggests that it may exhibit properties related to neurotransmitter modulation or receptor interaction, making it of interest in pharmacological research. The compound is likely to be soluble in organic solvents, and its stability may be influenced by pH and temperature. Additionally, its intricate structure may lead to unique interactions with biological targets, warranting further investigation into its therapeutic potential. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₂₁H₂₇N₅OS

InChI: InChI=1S/C21H27N5OS/c1-3-25(4-2)11-12-26-17-7-6-16(23-10-9-22)21-19(17)20(24-26)15-13-14(27)5-8-18(15)28-21/h5-8,13,23,27H,3-4,9-12,22H2,1-2H3

InChI key: InChIKey=UXIMOIBPXBNYNC-UHFFFAOYSA-N

SMILES: N(CCN)C1=C2C=3C(C=4C(S2)=CC=C(O)C4)=NN(CCN(CC)CC)C3C=C1

Synonyms:

• 2H-[1]Benzothiopyrano[4,3,2-cd]indazol-9-ol, 5-[(2-aminoethyl)amino]-2-[2-(diethylamino)ethyl]-
• 5-[(2-Aminoethyl)amino]-2-[2-(diethylamino)ethyl]-2H-[1]benzothiopyrano[4,3,2-cd]indazol-9-ol

PD 121373

CAS: 113457-06-0

PD 121373, a Benzothiopyrano-indazole, inhibits nucleic acid synthesis, equally affecting DNA/RNA.

Formula: C₂₁H₂₇N₅OS

Color and Shape: Solid

Molecular weight: 397.54

Ref: TM-T28320