CAS 113457-27-5
:4-[(2-chlorobenzyl)oxy]-3-methoxybenzoic acid
Description:
4-[(2-Chlorobenzyl)oxy]-3-methoxybenzoic acid, identified by its CAS number 113457-27-5, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with both a methoxy group and a chlorobenzyl ether. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitution. The presence of the chlorobenzyl group may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the methoxy group can influence the compound's solubility and reactivity. The compound's functional groups suggest it may participate in hydrogen bonding, affecting its physical properties like melting and boiling points. Its synthesis and applications may be relevant in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological contexts.
Formula:C15H13ClO4
InChI:InChI=1/C15H13ClO4/c1-19-14-8-10(15(17)18)6-7-13(14)20-9-11-4-2-3-5-12(11)16/h2-8H,9H2,1H3,(H,17,18)
SMILES:COc1cc(ccc1OCc1ccccc1Cl)C(=O)O
Synonyms:- 4-(2-Chloro-benzyloxy)-3-methoxy-benzoic acid
- Benzoic Acid, 4-[(2-Chlorophenyl)Methoxy]-3-Methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
