CAS 113457-32-2
:4-[(4-Fluorophenyl)methoxy]-3-methoxybenzoic acid
Description:
4-[(4-Fluorophenyl)methoxy]-3-methoxybenzoic acid, identified by its CAS number 113457-32-2, is an organic compound characterized by its complex aromatic structure. It features a benzoic acid core substituted with methoxy groups and a fluorophenyl moiety, which contributes to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water is generally low due to the hydrophobic nature of the aromatic rings. Its functional groups suggest potential for hydrogen bonding, which could affect its reactivity and interactions with other molecules. Additionally, the compound may undergo various chemical reactions typical of aromatic compounds, such as electrophilic substitution. Overall, its structural features position it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C15H13FO4
InChI:InChI=1S/C15H13FO4/c1-19-14-8-11(15(17)18)4-7-13(14)20-9-10-2-5-12(16)6-3-10/h2-8H,9H2,1H3,(H,17,18)
InChI key:InChIKey=YOJAJGCDFZQVTK-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(F)C=C1)C2=C(OC)C=C(C(O)=O)C=C2
Synonyms:- Benzoic acid, 4-[(4-fluorophenyl)methoxy]-3-methoxy-
- 4-[(4-Fluorophenyl)methoxy]-3-methoxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.