CymitQuimica logo

CAS 113457-35-5

:

4-[(3-Chlorophenyl)methoxy]-3-methoxybenzoic acid

Description:
4-[(3-Chlorophenyl)methoxy]-3-methoxybenzoic acid, with the CAS number 113457-35-5, is an organic compound characterized by its complex aromatic structure. It features a benzoic acid core substituted with methoxy groups and a chlorophenyl moiety, which contributes to its chemical properties and potential biological activity. The presence of the methoxy groups enhances its lipophilicity, potentially influencing its solubility and reactivity. The chlorophenyl group may impart specific electronic effects, affecting the compound's interaction with biological targets. This compound is likely to exhibit moderate to high stability under standard conditions, although its reactivity can vary depending on the functional groups present. It may be of interest in pharmaceutical research due to its structural features, which could be relevant in the development of therapeutic agents. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical and biological applications.
Formula:C15H13ClO4
InChI:InChI=1S/C15H13ClO4/c1-19-14-8-11(15(17)18)5-6-13(14)20-9-10-3-2-4-12(16)7-10/h2-8H,9H2,1H3,(H,17,18)
InChI key:InChIKey=MKKHRLMGOCPXBP-UHFFFAOYSA-N
SMILES:O(CC1=CC(Cl)=CC=C1)C2=C(OC)C=C(C(O)=O)C=C2
Synonyms:
  • Benzoic acid, 4-[(3-chlorophenyl)methoxy]-3-methoxy-
  • 4-[(3-Chlorophenyl)methoxy]-3-methoxybenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.