CAS 1134643-90-5

Borate(1-), (1,2-dimethyl-1-propen-1-yl)trifluoro-, potassium (1:1), (T-4)-

Description:

Borate(1-), (1,2-dimethyl-1-propen-1-yl)trifluoro-, potassium (1:1), commonly referred to by its CAS number 1134643-90-5, is a chemical compound that features a borate anion with a specific organic substituent. This compound typically exhibits characteristics associated with both boron and organic functional groups. The presence of the trifluoro group suggests that it may have significant electronegativity and potential reactivity, particularly in polar solvents. The potassium cation indicates that it is likely soluble in water and may participate in ionic interactions. The organic portion, derived from 1,2-dimethyl-1-propen-1-yl, suggests that the compound may have applications in organic synthesis or as a reagent in various chemical reactions. Overall, this compound's unique structure may impart specific properties such as stability, reactivity, and solubility, making it of interest in both industrial and research settings. However, detailed safety and handling information should be consulted due to the potential hazards associated with its components.

Formula: C₅H₉BF₃·K

InChI: InChI=1S/C5H9BF3.K/c1-4(2)5(3)6(7,8)9;/h1-3H3;/q-1;+1

InChI key: InChIKey=GYUUSPIOJSPUJM-UHFFFAOYSA-N

SMILES: [C-]([B+3]([F-])([F-])[F-])(=C(C)C)C.[K+]

Synonyms:

• Borate(1-), (1,2-dimethyl-1-propen-1-yl)trifluoro-, potassium (1:1), (T-4)-