CymitQuimica logo

CAS 113474-25-2

:

1,3-dimethyl 5-hydroxycyclohexane-1,3-dicarboxylate

Description:
1,3-Dimethyl 5-hydroxycyclohexane-1,3-dicarboxylate is an organic compound characterized by its cyclohexane ring structure, which features two carboxylate groups and a hydroxyl group. This compound is a derivative of cyclohexane, with two methyl groups attached at the 1 and 3 positions, enhancing its hydrophobic characteristics. The presence of the hydroxyl group at the 5 position contributes to its potential for hydrogen bonding, which can influence its solubility and reactivity. As a dicarboxylate, it can participate in various chemical reactions, including esterification and condensation. The compound's molecular structure suggests it may exhibit interesting properties such as moderate polarity and potential applications in pharmaceuticals or as a building block in organic synthesis. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1,3-dimethyl 5-hydroxycyclohexane-1,3-dicarboxylate is a versatile compound with potential utility in various chemical applications.
Formula:C10H16O5
InChI:InChI=1S/C10H16O5/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h6-8,11H,3-5H2,1-2H3
InChI key:WINOVBXKECSWMZ-UHFFFAOYSA-N
SMILES:COC(=O)C1CC(CC(C1)O)C(=O)OC
Synonyms:
  • 1,3diMethyl 5hydroxycyclohexane1,3dicarboxylate
  • 1,3-Cyclohexanedicarboxylic acid, 5-hydroxy-, 1,3-dimethyl ester
  • Dimethyl 5-hydroxycyclohexane-1,3-dicarboxylate
  • 5-hydroxy-cyclohexane-1,3-dicarboxylic acid dimethyl ester
Found 3 products.