CAS 1134776-52-5

Methyl 3-fluoro-4-(1-hydroxyethyl)benzoate

Description:

Methyl 3-fluoro-4-(1-hydroxyethyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. The presence of a methyl ester group indicates that it is a methyl ester, while the 3-fluoro and 4-(1-hydroxyethyl) substituents on the benzene ring contribute to its unique chemical properties. The fluorine atom introduces electronegativity, potentially affecting the compound's reactivity and polarity. The hydroxyethyl group adds a hydroxyl functional group, which can participate in hydrogen bonding, influencing solubility and reactivity. This compound may exhibit moderate to high solubility in polar solvents due to the presence of the hydroxyl group, while the aromatic ring contributes to its stability and potential for various chemical reactions, such as electrophilic substitution. Methyl 3-fluoro-4-(1-hydroxyethyl)benzoate may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior.

Formula: C₁₀H₁₁FO₃

InChI: InChI=1S/C10H11FO3/c1-6(12)8-4-3-7(5-9(8)11)10(13)14-2/h3-6,12H,1-2H3

InChI key: InChIKey=VFZZRNVDOCSWED-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(F)=C(C(C)O)C=C1

Synonyms:

• Benzoic acid, 3-fluoro-4-(1-hydroxyethyl)-, methyl ester
• 3-Fluoro-4-(1-hydroxyethyl)benzoic acid methyl ester
• Methyl 3-fluoro-4-(1-hydroxyethyl)benzoate