CAS 113479-88-2
:4-(3-Phenyl-2-propyn-1-yl)-2-azetidinone
Description:
4-(3-Phenyl-2-propyn-1-yl)-2-azetidinone, identified by its CAS number 113479-88-2, is a chemical compound characterized by its azetidinone core structure, which is a four-membered lactam. This compound features a phenyl group and a propynyl substituent, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the azetidinone ring suggests that it may exhibit interesting biological activities, possibly acting as a scaffold for drug development. Its structural features may influence its solubility, stability, and interaction with biological targets. Additionally, the compound's synthesis typically involves multi-step organic reactions, highlighting its complexity and the need for careful handling in laboratory settings. As with many organic compounds, understanding its properties, such as melting point, boiling point, and reactivity, is crucial for its application in research and industry. Overall, 4-(3-Phenyl-2-propyn-1-yl)-2-azetidinone represents a valuable compound for further exploration in chemical and pharmaceutical research.
Formula:C12H11NO
InChI:InChI=1S/C12H11NO/c14-12-9-11(13-12)8-4-7-10-5-2-1-3-6-10/h1-3,5-6,11H,8-9H2,(H,13,14)
InChI key:InChIKey=PPPNRFBGZIVOSX-UHFFFAOYSA-N
SMILES:C(C#CC1=CC=CC=C1)C2CC(=O)N2
Synonyms:- 4-(3-Phenyl-2-propyn-1-yl)-2-azetidinone
- 2-Azetidinone, 4-(3-phenyl-2-propyn-1-yl)-
- 2-Azetidinone, 4-(3-phenyl-2-propynyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
