
CAS 113482-94-3
:Tetrahydrobisdemethoxycurcumin
Description:
Tetrahydrobisdemethoxycurcumin is a synthetic derivative of curcumin, which is a natural polyphenolic compound found in turmeric. This compound is characterized by its unique chemical structure, which includes multiple hydroxyl groups that contribute to its potential antioxidant and anti-inflammatory properties. Tetrahydrobisdemethoxycurcumin is known for its enhanced bioavailability compared to curcumin, making it a subject of interest in pharmacological research. It exhibits a range of biological activities, including anti-cancer, anti-microbial, and neuroprotective effects, which are attributed to its ability to modulate various signaling pathways. The compound is typically studied in the context of its therapeutic potential, particularly in cancer treatment and prevention. Its solubility and stability in biological systems are also key characteristics that influence its efficacy. As research continues, Tetrahydrobisdemethoxycurcumin may offer insights into novel therapeutic strategies and applications in medicine.
Formula:C19H20O4
InChI:InChI=1S/C19H20O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-4,7-10,20-21H,5-6,11-13H2
InChI key:InChIKey=KTRRXJQAOOYSDA-UHFFFAOYSA-N
SMILES:C(CC(CC(CCC1=CC=C(O)C=C1)=O)=O)C2=CC=C(O)C=C2
Synonyms:- 3,5-Heptanedione, 1,7-bis(4-hydroxyphenyl)-
- Tetrahydrobisdemethoxycurcumin
- 1,7-Bis(4-hydroxyphenyl)-heptane-3,5-dione
- 1,7-Bis(4-hydroxyphenyl)-3,5-heptanedione
- Letestuianin C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tetrahydrobisdemethoxycurcumin
CAS:Controlled ProductFormula:C19H20O4Color and Shape:NeatMolecular weight:312.36
