
CAS 113486-30-9
:2,4-Nonanedione, 3-propyl-
Description:
2,4-Nonanedione, 3-propyl- is an organic compound characterized by its diketone structure, featuring two carbonyl (C=O) groups located at the 2nd and 4th positions of a nonane chain, with a propyl group attached at the 3rd position. This compound belongs to the class of diketones, which are known for their reactivity and ability to participate in various chemical reactions, including condensation and oxidation. It is typically a colorless to pale yellow liquid with a distinctive odor, which may contribute to its applications in flavoring and fragrance industries. The presence of the propyl group influences its physical properties, such as boiling point and solubility, making it more hydrophobic compared to simpler diketones. Additionally, 2,4-nonanedione derivatives may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and exposure guidelines, as diketones can pose health risks if not managed properly.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c1-4-6-7-9-12(14)11(8-5-2)10(3)13/h11H,4-9H2,1-3H3
InChI key:InChIKey=VNEYOWRODFMBOV-UHFFFAOYSA-N
SMILES:C(C(CCCCC)=O)(CCC)C(C)=O
Synonyms:- 3-Propylnonane-2,4-dione
- 2,4-Nonanedione, 3-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
