CAS 113490-76-9: TRANS METHYL O-BENZYL-L-4-HYDROXYPROLINE

Description:Trans Methyl O-benzyl-L-4-hydroxyproline, with the CAS number 113490-76-9, is an organic compound that belongs to the class of proline derivatives. It features a proline backbone with a hydroxyl group at the 4-position and a benzyl group attached via an ether linkage at the oxygen atom. This compound is characterized by its chiral nature, as proline is an amino acid, which can exist in different stereoisomeric forms. The trans configuration indicates the specific spatial arrangement of substituents around the proline ring, which can influence its biological activity and interactions. Typically, compounds like this may exhibit properties such as solubility in organic solvents, potential biological activity, and the ability to participate in various chemical reactions, including those typical of amino acids and their derivatives. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways or conditions. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula:C₁₃H₁₇NO₃

InChI:InChI=1/C13H17NO3/c1-16-13(15)12-7-11(8-14-12)17-9-10-5-3-2-4-6-10/h2-6,11-12,14H,7-9H2,1H3/t11-,12+/m1/s1

Synonyms:
methyl (4R)-4-(benzyloxy)-L-prolinate

Found 3 products.

Product data	Purity	Price range	Estimated delivery
L-Proline, 4-(phenylmethoxy)-, methyl ester, (4R)- REF: IN-DA0008QTCAS: 113490-76-9	97%	127.00 €~198.00 €	Mon 03 Mar 25
Methyl (2S,4R)-4-(benzyloxy)pyrrolidine-2-carboxylate REF: 10-F605659CAS: 113490-76-9	98%	- - -	Discontinued product
Trans methyl o-benzyl-L-4-hydroxyproline REF: 3D-NEA49076CAS: 113490-76-9	Min. 95%	- - -	Discontinued product