CymitQuimica logo

CAS 113496-13-2

:

3-(2-Methoxy-2-oxoethoxy)benzoic acid

Description:
3-(2-Methoxy-2-oxoethoxy)benzoic acid, with the CAS number 113496-13-2, is an organic compound characterized by its benzoic acid structure modified with a methoxy-oxoethoxy substituent. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential solubility in polar solvents due to the presence of the methoxy and carboxylic acid groups. The methoxy group can enhance the compound's lipophilicity, while the carboxylic acid group contributes to its acidity and potential for hydrogen bonding. This compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, such as esterification or amidation, and may serve as a precursor or intermediate in synthetic organic chemistry. Additionally, the presence of the oxo group indicates potential reactivity in oxidation-reduction processes. Overall, 3-(2-Methoxy-2-oxoethoxy)benzoic acid is a versatile compound with applications in both research and industry.
Formula:C10H10O5
InChI:InChI=1S/C10H10O5/c1-14-9(11)6-15-8-4-2-3-7(5-8)10(12)13/h2-5H,6H2,1H3,(H,12,13)
InChI key:InChIKey=HWVYHIGFOQWPMJ-UHFFFAOYSA-N
SMILES:O(CC(OC)=O)C1=CC(C(O)=O)=CC=C1
Synonyms:
  • 3-(2-Methoxy-2-oxoethoxy)benzoic acid
  • Benzoic acid, 3-(2-methoxy-2-oxoethoxy)-
  • 3-[(Methoxycarbonyl)methoxy]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.