
CAS 1134960-41-0
:3-Furancarboxylic acid, 2,5-dihydro-4-hydroxy-2-oxo-, methyl ester, sodium salt (1:1)
Description:
3-Furancarboxylic acid, 2,5-dihydro-4-hydroxy-2-oxo-, methyl ester, sodium salt (1:1), identified by CAS number 1134960-41-0, is a chemical compound that features a furan ring, which is a five-membered aromatic heterocycle containing oxygen. This compound is characterized by its carboxylic acid functionality, which is esterified with a methyl group, and it also contains a sodium salt form, indicating its potential solubility in water and utility in various applications. The presence of hydroxyl and carbonyl groups contributes to its reactivity and potential as a precursor in organic synthesis. Its structure suggests it may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the sodium salt form enhances its stability and solubility, which can be advantageous in formulations. Overall, this compound represents a unique combination of features that may be exploited in various chemical and industrial applications.
Formula:C6H6O5·Na
InChI:InChI=1S/C6H6O5.Na/c1-10-5(8)4-3(7)2-11-6(4)9;/h7H,2H2,1H3;
InChI key:InChIKey=MEVBPSYWTCDIMK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)COC1=O.[Na]
Synonyms:- 3-Furancarboxylic acid, 2,5-dihydro-4-hydroxy-2-oxo-, methyl ester, sodium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2,5-Dihydro-4-hydroxy-2-oxo-3-furancarboxylic Acid-d2 Ester Sodium Salt
CAS:Controlled ProductFormula:C6D2H3NaO5Color and Shape:NeatMolecular weight:182.103
