CAS 1135-23-5: 3-(4-Hydroxymethyl)propionic acid
Description:3-(4-Hydroxymethyl)propionic acid, also known as HMPA, is an organic compound characterized by its carboxylic acid functional group and a hydroxymethyl substituent on the propionic acid backbone. It appears as a white crystalline solid and is soluble in water due to the presence of both polar hydroxyl and carboxyl groups. This compound is notable for its role as a building block in organic synthesis and polymer chemistry, particularly in the production of polyesters and other polymers. Its structure allows for the introduction of functional groups, making it versatile in various chemical reactions. Additionally, HMPA can participate in esterification and amidation reactions, contributing to the formation of more complex molecules. The compound is also of interest in biochemical applications, where it may serve as a precursor or intermediate in the synthesis of biologically active compounds. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation or adverse reactions.
Formula:C10H11O4
InChI:InChI=1S/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13)
InChI key:InChIKey=BOLQJTPHPSDZHR-UHFFFAOYSA-N
SMILES:O=C(O)CCC1=CC=C(O)C(OC)=C1
- Synonyms:
- (4-Hydroxy-3-methoxyphenyl)propionic acid
- 3-(3-Methoxy-4-hydroxyphenyl)propanoic acid
- 3-(3-Methoxy-4-hydroxyphenyl)propionic acid
- 3-(4-Hydroxy-3-Methoxyphenyl)Propanoate
- 3-(4-Hydroxy-3-Methoxyphenyl)Propanoic Acid
- 3-(4-Hydroxy-3-methoxyphenyl)propionic acid
- 3-Methoxy-4-hydroxyphenylpropionic acid
- 3-Methoxyphloretic acid
- 4-Hydroxy-3-methoxybenzenepropanoic acid
- Benzenepropanoic acid, 4-hydroxy-3-methoxy-
- See more synonyms
- Dihydroconiferylic acid
- Dihydroferulic acid
- Ferulic acid, α,β-dihydro-
- Hydrocinnamic acid, 4-hydroxy-3-methoxy-
- Hydroferulic acid
- Shorbic acid
- β-(4-Hydroxy-3-methoxyphenyl)propionic acid
- β-3-Methoxy-4-hydroxyphenylpropionic acid