CAS 1135-24-6: Ferulic acid
Description:Ferulic acid is a naturally occurring phenolic compound, classified as a hydroxycinnamic acid. It is commonly found in various plant sources, including fruits, vegetables, and grains, particularly in the cell walls of plants. The chemical formula of ferulic acid is C10H10O4, and it features a distinctive structure that includes a vinyl group and a methoxy group, contributing to its antioxidant properties. Ferulic acid is known for its ability to scavenge free radicals, making it a valuable compound in skincare formulations for its potential anti-aging effects. Additionally, it exhibits anti-inflammatory and antimicrobial properties, which further enhance its utility in both food preservation and cosmetic applications. Ferulic acid is also recognized for its role in plant defense mechanisms, helping to protect against environmental stressors. Its solubility in alcohol and organic solvents, along with its stability under UV light, makes it a versatile ingredient in various formulations. Overall, ferulic acid is a significant compound in both the food and cosmetic industries due to its beneficial health properties.
Formula:C10H10O4
InChI:InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)
InChI key:InChIKey=KSEBMYQBYZTDHS-UHFFFAOYSA-N
SMILES:O=C(O)C=CC1=CC=C(O)C(OC)=C1
- Synonyms:
- (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
- (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-
- 3-(4-Hydroxy-3-Methoxyphenyl)Prop-2-Enoic Acid
- 3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid
- 3-(4-Hydroxy-3-methoxyphenyl)acrylic acid
- 3-Methoxy-4-hydroxycinnamic acid
- 4-Hydroxy-3-methoxyzimtsaure
- Acide 4-hydroxy-3-methoxycinnamique
- Acido 4-Hidroxi-3-Metoxicinamico
- See more synonyms
- Cinnamic Acid, 4-Hydroxy-3-Methoxy-
- Coniferic acid
- Ferulaic acid
- Ferulic acid
- Nsc 2821
- Nsc 51986
- Nsc 674320
- 4-Hydroxy-3-methoxycinnamic acid
