
CAS 1135-51-9
:2,2′-[1,2-Ethanediylbis(oxy)]bis[1,3,2-dioxaborolane]
Description:
2,2′-[1,2-Ethanediylbis(oxy)]bis[1,3,2-dioxaborolane], commonly referred to by its CAS number 1135-51-9, is a chemical compound characterized by its boron-containing structure. This compound features two dioxaborolane rings connected by an ethylene glycol moiety, which contributes to its unique properties. The dioxaborolane rings are five-membered cyclic compounds that contain both boron and oxygen, making them useful in various chemical applications, particularly in organic synthesis and materials science. The presence of the ethylene glycol linker enhances the solubility and stability of the compound in polar solvents. Additionally, the compound may exhibit interesting reactivity due to the boron atoms, which can participate in coordination chemistry and catalysis. Its applications may extend to areas such as drug delivery, polymer chemistry, and as a building block in the synthesis of more complex organic molecules. Overall, this compound is notable for its structural features and potential utility in various chemical contexts.
Formula:C6H12B2O6
InChI:InChI=1S/C6H12B2O6/c1-2-10-7(9-1)13-5-6-14-8-11-3-4-12-8/h1-6H2
InChI key:InChIKey=JUHHPHPMDHWWQW-UHFFFAOYSA-N
SMILES:O(CCOB1OCCO1)B2OCCO2
Synonyms:- 2,2′-[1,2-Ethanediylbis(oxy)]bis[1,3,2-dioxaborolane]
- Ethylene glycol, cyclic ester with boric acid (H3BO3) ethylene ester (2:1)
- 1,3,2-Dioxaborolane, 2,2′-[1,2-ethanediylbis(oxy)]bis-
- Ethylene borate
- Ethylene borate ([(C2H4O2)BO]2(C2H4))
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,2-Dioxaborolane, 2,2'-[1,2-ethanediylbis(oxy)]bis-
CAS:Formula:C6H12B2O6Molecular weight:201.7779
