
CAS 1135-61-1
:5-Ethyl-5-(2-methylpropyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
5-Ethyl-5-(2-methylpropyl)-2,4,6(1H,3H,5H)-pyrimidinetrione, with CAS number 1135-61-1, is a pyrimidine derivative characterized by its unique structure that includes a pyrimidine ring substituted with ethyl and 2-methylpropyl groups. This compound typically exhibits properties associated with pyrimidine derivatives, such as potential biological activity and solubility in organic solvents. It may participate in various chemical reactions due to the presence of functional groups, making it of interest in medicinal chemistry and organic synthesis. The presence of multiple carbon substituents can influence its physical properties, such as melting point and boiling point, as well as its reactivity. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of this substance would depend on its concentration and exposure levels.
Formula:C10H16N2O3
InChI:InChI=1S/C10H16N2O3/c1-4-10(5-6(2)3)7(13)11-9(15)12-8(10)14/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15)
InChI key:InChIKey=OSVIDGCVOGPEOK-UHFFFAOYSA-N
SMILES:C(C(C)C)C1(CC)C(=O)NC(=O)NC1=O
Synonyms:- 5-Ethyl-5-(2-methylpropyl)barbituric acid
- Barbituric acid, 5-ethyl-5-isobutyl-
- 5-Ethyl-5-(2-methylpropyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(2-methylpropyl)-
CAS:Formula:C10H16N2O3Molecular weight:212.2456
