CAS 1135-63-3

β-Ethyl-β-methyl-α-phenyl-1-aziridineethanol

Description:

β-Ethyl-β-methyl-α-phenyl-1-aziridineethanol, with the CAS number 1135-63-3, is a chemical compound characterized by its aziridine ring structure, which is a three-membered cyclic amine. This compound features a hydroxyl group (-OH) attached to the aziridine, contributing to its potential as a chiral building block in organic synthesis. The presence of ethyl and methyl groups at the β-position and a phenyl group at the α-position enhances its steric and electronic properties, making it of interest in medicinal chemistry and synthetic applications. The aziridine moiety is known for its reactivity, particularly in nucleophilic substitution reactions, which can be exploited in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting biological activities due to its structural features, although specific biological data would require further investigation. Overall, β-Ethyl-β-methyl-α-phenyl-1-aziridineethanol is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₃H₁₉NO

InChI: InChI=1S/C13H19NO/c1-3-13(2,14-9-10-14)12(15)11-7-5-4-6-8-11/h4-8,12,15H,3,9-10H2,1-2H3

InChI key: InChIKey=XLWZBTOYPSSQQV-UHFFFAOYSA-N

SMILES: C(C(O)C1=CC=CC=C1)(CC)(C)N2CC2

Synonyms:

• β-Ethyl-β-methyl-α-phenyl-1-aziridineethanol
• 2-Aziridin-1-yl-2-methyl-1-phenyl-butan-1-ol
• 1-Aziridineethanol, β-ethyl-β-methyl-α-phenyl-
• NSC 407116

1-Aziridineethanol, β-ethyl-β-methyl-α-phenyl-

CAS: 1135-63-3

Formula: C₁₃H₁₉NO

Molecular weight: 205.2961

Ref: IN-DA0008S4