CAS 1135-70-2

2-Ethyl-2-phenyl-1,3-dioxolane-4-methanol

Description:

2-Ethyl-2-phenyl-1,3-dioxolane-4-methanol, with the CAS number 1135-70-2, is an organic compound characterized by its unique dioxolane ring structure, which incorporates both ethyl and phenyl substituents. This compound features a methanol group, contributing to its potential solubility in polar solvents. The presence of the dioxolane ring suggests that it may exhibit properties typical of cyclic ethers, such as moderate stability and reactivity under certain conditions. Its molecular structure indicates potential applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. The compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the steric effects of the ethyl and phenyl groups, as well as the presence of the hydroxymethyl group. Additionally, the compound may exhibit interesting chemical reactivity due to the functional groups present, making it a subject of interest in both academic and industrial research settings.

Formula: C₁₂H₁₆O₃

InChI: InChI=1S/C12H16O3/c1-2-12(10-6-4-3-5-7-10)14-9-11(8-13)15-12/h3-7,11,13H,2,8-9H2,1H3

InChI key: InChIKey=MNDLRZFXJPXXCG-UHFFFAOYSA-N

SMILES: C(C)C1(OC(CO)CO1)C2=CC=CC=C2

Synonyms:

• 1,3-Dioxolane-4-methanol, 2-ethyl-2-phenyl-
• K 61
• 1-Propanone, 1-phenyl-, cyclic 1-(hydroxymethyl)-1,2-ethanediyl acetal
• NSC 27568
• 2-Ethyl-2-phenyl-1,3-dioxolane-4-methanol

1,3-Dioxolane-4-methanol, 2-ethyl-2-phenyl-

CAS: 1135-70-2

Formula: C₁₂H₁₆O₃

Molecular weight: 208.2536

Ref: IN-DA0008S2