CAS 113507-88-3

Ethanesulfonic acid, 2,2′-oxybis[1,1,2,2-tetrafluoro-, disodium salt

Description:

Ethanesulfonic acid, 2,2′-oxybis[1,1,2,2-tetrafluoro-, disodium salt, commonly referred to as a disodium salt of a sulfonic acid, is a chemical compound characterized by its unique structure that includes a sulfonic acid group and multiple fluorinated carbon chains. This compound is typically used in various applications, including as a reagent in organic synthesis and in the development of specialty chemicals. Its fluorinated nature imparts properties such as increased thermal stability and hydrophobicity, making it suitable for use in harsh chemical environments. The presence of the disodium salt form enhances its solubility in water, facilitating its use in aqueous solutions. Additionally, the compound may exhibit low toxicity and environmental persistence, which are important considerations in its application and handling. Overall, the characteristics of this compound make it valuable in both industrial and research settings, particularly in fields requiring high-performance materials.

Formula: C₄H₂F₈O₇S₂·2Na

InChI: InChI=1S/C4H2F8O7S2.2Na/c5-1(6,3(9,10)20(13,14)15)19-2(7,8)4(11,12)21(16,17)18;;/h(H,13,14,15)(H,16,17,18);;

InChI key: InChIKey=KTZXGGYAIHECDT-UHFFFAOYSA-N

SMILES: C(C(S(=O)(=O)O)(F)F)(OC(C(S(=O)(=O)O)(F)F)(F)F)(F)F.[Na]

Synonyms:

• Ethanesulfonic acid, 2,2′-oxybis[1,1,2,2-tetrafluoro-, disodium salt